CAS 62572-93-4 appears in our catalog under these names: (RS)-1-(4-Hydroxymethylphenoxy)-3-isopropylaminopropan-2-ol, Bisoprolol EP Impurity A, Bisoprolol EP Impurity A, Bisoprolol USP RC A, Bisoprolol Impurity 1（Bisoprolol EP Impurity A）, Des(isopropoxyethyl) Bisoprolol, >95% (HPLC). Offered by: Mikromol, Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 25mg, 100mg, on request, 10mg, 50mg, 200mg, 250mg, 1g.
1-[4-(hydroxymethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 62572-93-4) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: 1-[4-(hydroxymethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: XWWMQUXRXOEXDS-UHFFFAOYSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | 1-[4-(hydroxymethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | XWWMQUXRXOEXDS-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CO)O |
Computed by PubChem (NCBI)