CAS 62573-11-9 appears in our catalog under these names: Peg10-ots, 95%, Tos–PEG9, Tos-PEG9 95%, 26-Hydroxy-3,6,9,12,15,18,21,24-octaoxahexacosyl 4-methylbenzenesulfonate, 97%, 97%, Tos-PEG9, 97.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 250 mg, 5 g, 1 g.
2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 62573-11-9) is a chemical compound with the molecular formula C25H44O12S and a molecular weight of 568.7 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: IJODQQRFMNRBNF-UHFFFAOYSA-N.
| Molecular formula | C25H44O12S |
|---|---|
| Molecular weight | 568.7 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | IJODQQRFMNRBNF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)