CAS 62613-15-4 appears in our catalog under these names: Diphenyliodonium hexafluoroarsenate, Diphenyliodonium Hexafluoroarsenate, >98.0%(T)(HPLC). Offered by: GLPBio, TCI. Available pack sizes: 1g.
Diphenyliodanium;hexafluoroarsenic(1-) (CAS 62613-15-4) is a chemical compound with the molecular formula C12H10AsF6I and a molecular weight of 470.02 g/mol. IUPAC name: diphenyliodanium;hexafluoroarsenic(1-). InChIKey: KFGZTBBPOZNSHA-UHFFFAOYSA-N.
| Molecular formula | C12H10AsF6I |
|---|---|
| Molecular weight | 470.02 g/mol |
| IUPAC name | diphenyliodanium;hexafluoroarsenic(1-) |
| InChIKey | KFGZTBBPOZNSHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[I+]C2=CC=CC=C2.F[As-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)