CAS 626209-94-7 appears in our catalog under these names: N-(4-tert-Butyl-1,3-thiazol-2-yl)-3-methylbutanamide, 95%, N-(4-tert-Butyl-1,3-thiazol-2-yl)-3-methylbutanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylbutanamide (CAS 626209-94-7) is a chemical compound with the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. IUPAC name: N-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylbutanamide. InChIKey: USEFZEAYXDKSQR-UHFFFAOYSA-N.
| Molecular formula | C12H20N2OS |
|---|---|
| Molecular weight | 240.37 g/mol |
| IUPAC name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylbutanamide |
| InChIKey | USEFZEAYXDKSQR-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)NC1=NC(=CS1)C(C)(C)C |
Computed by PubChem (NCBI)