Products 62637-92-7
CAS 62637-92-7 appears in our catalog under these names: N,N-Diethyl-p-phenylenediamine oxalate, 95%, N1,N1-Diethylbenzene-1,4-diamine hemioxalate, 98%, N,N–Diethyl–p–phenylenediamine oxalate, N,N-Diethyl-p-phenylenediamine oxalate, N,N-Diethyl-p-phenylenediamine oxalate, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 5g, 25g, 1g, 100g, 0,1kg, 10g, 500g.
Bis(4-N,4-N-diethylbenzene-1,4-diamine);oxalic acid (CAS 62637-92-7) is a chemical compound with the molecular formula C22H34N4O4 and a molecular weight of 418.5 g/mol. IUPAC name: bis(4-N,4-N-diethylbenzene-1,4-diamine);oxalic acid. InChIKey: JJEXNPALAITIMN-UHFFFAOYSA-N.
| Molecular formula | C22H34N4O4 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | bis(4-N,4-N-diethylbenzene-1,4-diamine);oxalic acid |
| InChIKey | JJEXNPALAITIMN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)N.CCN(CC)C1=CC=C(C=C1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)