CAS 62638-00-0 appears in our catalog under these names: Lithium 4-cyclohexylbutanoate, 95+%, LITHIUM CYCLOHEXANEBUTYRATE. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 50mg.
Lithium 4-cyclohexylbutanoate (CAS 62638-00-0) is a chemical compound with the molecular formula C10H17LiO2 and a molecular weight of 176.2 g/mol. IUPAC name: lithium 4-cyclohexylbutanoate. InChIKey: URLCIQQRJXWBIF-UHFFFAOYSA-M.
| Molecular formula | C10H17LiO2 |
|---|---|
| Molecular weight | 176.2 g/mol |
| IUPAC name | lithium 4-cyclohexylbutanoate |
| InChIKey | URLCIQQRJXWBIF-UHFFFAOYSA-M |
| SMILES | [Li+].C1CCC(CC1)CCCC(=O)[O-] |
Computed by PubChem (NCBI)