CAS 62638-03-3 is the registry number for Potassium cyclohexanebutyrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Potassium 4-cyclohexylbutanoate (CAS 62638-03-3) is a chemical compound with the molecular formula C10H17KO2 and a molecular weight of 208.34 g/mol. IUPAC name: potassium 4-cyclohexylbutanoate. InChIKey: LBYNWSSEILNGLN-UHFFFAOYSA-M.
| Molecular formula | C10H17KO2 |
|---|---|
| Molecular weight | 208.34 g/mol |
| IUPAC name | potassium 4-cyclohexylbutanoate |
| InChIKey | LBYNWSSEILNGLN-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)CCCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)