CAS 62638-05-5 is the registry number for Strontium cyclohexanebutyrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Strontium bis(4-cyclohexylbutanoate) (CAS 62638-05-5) is a chemical compound with the molecular formula C20H34O4Sr and a molecular weight of 426.1 g/mol. IUPAC name: strontium bis(4-cyclohexylbutanoate). InChIKey: JBJLAHGTZMLOAH-UHFFFAOYSA-L.
| Molecular formula | C20H34O4Sr |
|---|---|
| Molecular weight | 426.1 g/mol |
| IUPAC name | strontium bis(4-cyclohexylbutanoate) |
| InChIKey | JBJLAHGTZMLOAH-UHFFFAOYSA-L |
| SMILES | C1CCC(CC1)CCCC(=O)[O-].C1CCC(CC1)CCCC(=O)[O-].[Sr+2] |
Computed by PubChem (NCBI)