CAS 62673-71-6 appears in our catalog under these names: 2-Chloro-1-(3,4-dibromo-2-thienyl)-1-ethanone, 95%, 2-Chloro-1-(3,4-dibromo-2-thienyl)-1-ethanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2-chloro-1-(3,4-dibromothiophen-2-yl)ethanone (CAS 62673-71-6) is a chemical compound with the molecular formula C6H3Br2ClOS and a molecular weight of 318.41 g/mol. IUPAC name: 2-chloro-1-(3,4-dibromothiophen-2-yl)ethanone. InChIKey: DVHYHNZCCIEQQA-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2ClOS |
|---|---|
| Molecular weight | 318.41 g/mol |
| IUPAC name | 2-chloro-1-(3,4-dibromothiophen-2-yl)ethanone |
| InChIKey | DVHYHNZCCIEQQA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)C(=O)CCl)Br)Br |
Computed by PubChem (NCBI)