CAS 62675-68-7 appears in our catalog under these names: (R)-Methyl 2-amino-3-(tritylthio)propanoate hydrochloride, 95%, (R)-Methyl 2-amino-3-(tritylthio)propanoate hydrochloride, 97%, (R)-METHYL 2-AMINO-3-(TRITYLTHIO)PROPANOATE HCL, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 25g.
Methyl (2R)-2-amino-3-tritylsulfanylpropanoate;hydrochloride (CAS 62675-68-7) is a chemical compound with the molecular formula C23H24ClNO2S and a molecular weight of 414.0 g/mol. IUPAC name: methyl (2R)-2-amino-3-tritylsulfanylpropanoate;hydrochloride. InChIKey: BBLIVDURNAQWLB-BOXHHOBZSA-N.
| Molecular formula | C23H24ClNO2S |
|---|---|
| Molecular weight | 414.0 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-tritylsulfanylpropanoate;hydrochloride |
| InChIKey | BBLIVDURNAQWLB-BOXHHOBZSA-N |
| SMILES | COC(=O)[C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)