Products 62681-99-6
CAS 62681-99-6 appears in our catalog under these names: 2,5-Bis(3-fluorophenyl)-1,3,4-oxadiazole, 95%, Bis(3-fluorophenyl)-1,3,4-oxadiazole, 90%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
2,5-bis(3-fluorophenyl)-1,3,4-oxadiazole (CAS 62681-99-6) is a chemical compound with the molecular formula C14H8F2N2O and a molecular weight of 258.22 g/mol. IUPAC name: 2,5-bis(3-fluorophenyl)-1,3,4-oxadiazole. InChIKey: ROYCICSWSRZMRS-UHFFFAOYSA-N.
| Molecular formula | C14H8F2N2O |
|---|---|
| Molecular weight | 258.22 g/mol |
| IUPAC name | 2,5-bis(3-fluorophenyl)-1,3,4-oxadiazole |
| InChIKey | ROYCICSWSRZMRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NN=C(O2)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)