CAS 62686-19-5 appears in our catalog under these names: Dibenzo[a,c]phenazin-11-amine, 95%, Dibenzo(a,c)phenazin-11-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Phenanthro[9,10-b]quinoxalin-11-amine (CAS 62686-19-5) is a chemical compound with the molecular formula C20H13N3 and a molecular weight of 295.3 g/mol. IUPAC name: phenanthro[9,10-b]quinoxalin-11-amine. InChIKey: ZOOUFTURZKDEQL-UHFFFAOYSA-N.
| Molecular formula | C20H13N3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | phenanthro[9,10-b]quinoxalin-11-amine |
| InChIKey | ZOOUFTURZKDEQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=NC5=C(C=CC(=C5)N)N=C24 |
Computed by PubChem (NCBI)