CAS 62698-50-4 appears in our catalog under these names: Potassium 4-biphenylcarboxylate, 4-Biphenylcarboxylic acid potassium salt, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 25g, 50g, 100g, 1g, 10g, 5g.
Potassium 4-phenylbenzoate (CAS 62698-50-4) is a chemical compound with the molecular formula C13H9KO2 and a molecular weight of 236.31 g/mol. IUPAC name: potassium 4-phenylbenzoate. InChIKey: ACFHESBUIHLMNZ-UHFFFAOYSA-M.
| Molecular formula | C13H9KO2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | potassium 4-phenylbenzoate |
| InChIKey | ACFHESBUIHLMNZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)