Products 6270-44-6
CAS 6270-44-6 appears in our catalog under these names: 2'-Hydroxy-4'-methoxypropiophenone, 95%, 2'-Hydroxy-4'-methoxypropiophenone, 2'-Hydroxy-4'-methoxypropiophenone, >98.0%(GC), 1-(2-Hydroxy-4-methoxyphenyl)propan-1-one 98%, 1-(2-Hydroxy-4-Methoxyphenyl)Propan-1-One, 98%, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 50g, 100mg, 250mg.
1-(2-hydroxy-4-methoxyphenyl)propan-1-one (CAS 6270-44-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(2-hydroxy-4-methoxyphenyl)propan-1-one. InChIKey: MAKZPFSTXDXNJN-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(2-hydroxy-4-methoxyphenyl)propan-1-one |
| InChIKey | MAKZPFSTXDXNJN-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)OC)O |
Computed by PubChem (NCBI)