CAS 627085-15-8 appears in our catalog under these names: 1-Hydroxy-2,2,6,6-tetramethylpiperidin-4-yl cyclopropanecarboxylate hydrochloride, 95%, OT-551 HCl/ 99.71% (existing batch purity), 1-Hydroxy-2,2,6,6-tetramethylpiperidin-4-yl cyclopropanecarboxylate hcl, OT-551. Offered by: Combi-blocks, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) cyclopropanecarboxylate;hydrochloride (CAS 627085-15-8) is a chemical compound with the molecular formula C13H24ClNO3 and a molecular weight of 277.79 g/mol. IUPAC name: (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) cyclopropanecarboxylate;hydrochloride. InChIKey: BGEXDXBTNACMOP-UHFFFAOYSA-N.
| Molecular formula | C13H24ClNO3 |
|---|---|
| Molecular weight | 277.79 g/mol |
| IUPAC name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) cyclopropanecarboxylate;hydrochloride |
| InChIKey | BGEXDXBTNACMOP-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1O)(C)C)OC(=O)C2CC2)C.Cl |
Computed by PubChem (NCBI)