CAS 62715-80-4 is the registry number for Acetamide, N-acetyl-N-(2,4,6-tribromophenyl)-, 90%, 90%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-acetyl-N-(2,4,6-tribromophenyl)acetamide (CAS 62715-80-4) is a chemical compound with the molecular formula C10H8Br3NO2 and a molecular weight of 413.89 g/mol. IUPAC name: N-acetyl-N-(2,4,6-tribromophenyl)acetamide. InChIKey: PHSOGTQAFVFLHU-UHFFFAOYSA-N.
| Molecular formula | C10H8Br3NO2 |
|---|---|
| Molecular weight | 413.89 g/mol |
| IUPAC name | N-acetyl-N-(2,4,6-tribromophenyl)acetamide |
| InChIKey | PHSOGTQAFVFLHU-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1=C(C=C(C=C1Br)Br)Br)C(=O)C |
Computed by PubChem (NCBI)