CAS 62729-39-9 appears in our catalog under these names: 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid, 95-<97%, 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid, ≥97-<99%, 4–(5,5–dimethyl–1,3,2–dioxaborinan–2–yl)benzoic acid, 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid, 98%, 98%, 4-(5,5-DIMETHYL-1,3,2-DIOXABORINAN-2-YL)BENZOIC ACID, 99%+(LC-MS),RG. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid (CAS 62729-39-9) is a chemical compound with the molecular formula C12H15BO4 and a molecular weight of 234.06 g/mol. IUPAC name: 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid. InChIKey: IGZPAPRBHZGJHV-UHFFFAOYSA-N.
| Molecular formula | C12H15BO4 |
|---|---|
| Molecular weight | 234.06 g/mol |
| IUPAC name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid |
| InChIKey | IGZPAPRBHZGJHV-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)