CAS 62740-68-5 is the registry number for Ethylene Urea-d4, >95% (GC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
4,4,5,5-tetradeuterioimidazolidin-2-one (CAS 62740-68-5) is a chemical compound with the molecular formula C3H6N2O and a molecular weight of 90.12 g/mol. IUPAC name: 4,4,5,5-tetradeuterioimidazolidin-2-one. InChIKey: YAMHXTCMCPHKLN-LNLMKGTHSA-N.
| Molecular formula | C3H6N2O |
|---|---|
| Molecular weight | 90.12 g/mol |
| IUPAC name | 4,4,5,5-tetradeuterioimidazolidin-2-one |
| InChIKey | YAMHXTCMCPHKLN-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(NC(=O)N1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)