CAS 6275-99-6 appears in our catalog under these names: 2,2,2-Trifluoro-N-(4-sulfamoylphenyl)acetamide, 98%, 2,2,2-trifluoro-N-(4-sulfamoylphenyl)acetamide. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N-(4-sulfamoylphenyl)acetamide (CAS 6275-99-6) is a chemical compound with the molecular formula C8H7F3N2O3S and a molecular weight of 268.22 g/mol. IUPAC name: 2,2,2-trifluoro-N-(4-sulfamoylphenyl)acetamide. InChIKey: KYCGMLPXHVMDAN-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O3S |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(4-sulfamoylphenyl)acetamide |
| InChIKey | KYCGMLPXHVMDAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(F)(F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)