CAS 627525-33-1 is the registry number for EVT-101 (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3-(difluoromethyl)-4-fluorophenyl]-3-[(2-methylimidazol-1-yl)methyl]pyridazine (CAS 627525-33-1) is a chemical compound with the molecular formula C16H13F3N4 and a molecular weight of 318.30 g/mol. IUPAC name: 5-[3-(difluoromethyl)-4-fluorophenyl]-3-[(2-methylimidazol-1-yl)methyl]pyridazine. InChIKey: BOVUHBFXPNLTKF-UHFFFAOYSA-N.
| Molecular formula | C16H13F3N4 |
|---|---|
| Molecular weight | 318.30 g/mol |
| IUPAC name | 5-[3-(difluoromethyl)-4-fluorophenyl]-3-[(2-methylimidazol-1-yl)methyl]pyridazine |
| InChIKey | BOVUHBFXPNLTKF-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN1CC2=NN=CC(=C2)C3=CC(=C(C=C3)F)C(F)F |
Computed by PubChem (NCBI)