CAS 627526-26-5 is the registry number for 2-(1,2-Dihydroacenaphthylen-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(1,2-dihydroacenaphthylen-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 627526-26-5) is a chemical compound with the molecular formula C18H21BO2 and a molecular weight of 280.2 g/mol. IUPAC name: 2-(1,2-dihydroacenaphthylen-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QLPYPZPMUQTDAB-UHFFFAOYSA-N.
| Molecular formula | C18H21BO2 |
|---|---|
| Molecular weight | 280.2 g/mol |
| IUPAC name | 2-(1,2-dihydroacenaphthylen-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QLPYPZPMUQTDAB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C3CCC4=C3C2=CC=C4 |
Computed by PubChem (NCBI)