CAS 627536-09-8 appears in our catalog under these names: SD 208, SD-208/ 98%, SD–208, SCI 208, SD-208 99%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(5-chloro-2-fluorophenyl)-N-pyridin-4-ylpteridin-4-amine (CAS 627536-09-8) is a chemical compound with the molecular formula C17H10ClFN6 and a molecular weight of 352.8 g/mol. IUPAC name: 2-(5-chloro-2-fluorophenyl)-N-pyridin-4-ylpteridin-4-amine. InChIKey: BERLXWPRSBJFHO-UHFFFAOYSA-N.
| Molecular formula | C17H10ClFN6 |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 2-(5-chloro-2-fluorophenyl)-N-pyridin-4-ylpteridin-4-amine |
| InChIKey | BERLXWPRSBJFHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=NC3=NC=CN=C3C(=N2)NC4=CC=NC=C4)F |
Computed by PubChem (NCBI)