CAS 62754-26-1 appears in our catalog under these names: tert-Butyl 3,4-diaminobenzoate, 95%, tert-Butyl 3,4-diaminobenzoate, 95+%, tert-Butyl 3,4-diaminobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 0,5g, 50mg.
Tert-butyl 3,4-diaminobenzoate (CAS 62754-26-1) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: tert-butyl 3,4-diaminobenzoate. InChIKey: PSXWMTJULZJDAI-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | tert-butyl 3,4-diaminobenzoate |
| InChIKey | PSXWMTJULZJDAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)