Products 6277-18-5
CAS 6277-18-5 is the registry number for 2-Iodo-5-nitrothiophene. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-iodo-5-nitrothiophene (CAS 6277-18-5) is a chemical compound with the molecular formula C4H2INO2S and a molecular weight of 255.04 g/mol. IUPAC name: 2-iodo-5-nitrothiophene. InChIKey: IAHMSOROXQKFTN-UHFFFAOYSA-N.
| Molecular formula | C4H2INO2S |
|---|---|
| Molecular weight | 255.04 g/mol |
| IUPAC name | 2-iodo-5-nitrothiophene |
| InChIKey | IAHMSOROXQKFTN-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)