Products 62778-24-9

CAS 62778-24-9 appears in our catalog under these names: 6-(P-TOLUIDINO)-2-NAPHTHALENESULFONYL C&, 6-[(4-Methylphenyl)amino]-2-naphthalenesulfonyl chloride. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 250MG, 50MG.

Structural formula: {0} (CAS {1})

6-(4-methylanilino)naphthalene-2-sulfonyl chloride (CAS 62778-24-9) is a chemical compound with the molecular formula C17H14ClNO2S and a molecular weight of 331.8 g/mol. IUPAC name: 6-(4-methylanilino)naphthalene-2-sulfonyl chloride. InChIKey: NONZPGMJWHNDKP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14ClNO2S
Molecular weight331.8 g/mol
IUPAC name6-(4-methylanilino)naphthalene-2-sulfonyl chloride
InChIKeyNONZPGMJWHNDKP-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)NC2=CC3=C(C=C2)C=C(C=C3)S(=O)(=O)Cl

Computed by PubChem (NCBI)