CAS 627836-66-2 is the registry number for 1-(3,5-dichlorophenyl)-2,6,6-trimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3,5-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (CAS 627836-66-2) is a chemical compound with the molecular formula C17H17Cl2NO and a molecular weight of 322.2 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one. InChIKey: OBHKYJCIZUGEFJ-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2NO |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| InChIKey | OBHKYJCIZUGEFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC(=CC(=C3)Cl)Cl)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)