CAS 627838-41-9 is the registry number for 6-Hydrazinyl-N,N-bis(propan-2-yl)pyridine-3-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-hydrazinyl-N,N-di(propan-2-yl)pyridine-3-sulfonamide (CAS 627838-41-9) is a chemical compound with the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. IUPAC name: 6-hydrazinyl-N,N-di(propan-2-yl)pyridine-3-sulfonamide. InChIKey: JMGXAWUTRFIGLY-UHFFFAOYSA-N.
| Molecular formula | C11H20N4O2S |
|---|---|
| Molecular weight | 272.37 g/mol |
| IUPAC name | 6-hydrazinyl-N,N-di(propan-2-yl)pyridine-3-sulfonamide |
| InChIKey | JMGXAWUTRFIGLY-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C1=CN=C(C=C1)NN |
Computed by PubChem (NCBI)