CAS 627843-31-6 appears in our catalog under these names: N,N-Dibenzyl-6-oxo-1,6-dihydropyridine-3-sulfonamide, 95%, N,N-Dibenzyl-6-oxo-1,6-dihydropyridine-3-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
N,N-dibenzyl-6-oxo-1H-pyridine-3-sulfonamide (CAS 627843-31-6) is a chemical compound with the molecular formula C19H18N2O3S and a molecular weight of 354.4 g/mol. IUPAC name: N,N-dibenzyl-6-oxo-1H-pyridine-3-sulfonamide. InChIKey: DOLLAWUAGVXNQD-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3S |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | N,N-dibenzyl-6-oxo-1H-pyridine-3-sulfonamide |
| InChIKey | DOLLAWUAGVXNQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)S(=O)(=O)C3=CNC(=O)C=C3 |
Computed by PubChem (NCBI)