CAS 62790-26-5 appears in our catalog under these names: Benzoate–d5 sodium, Sodium Benzoate-d5, 98 atom % D, min 98% Chemical Purity, Sodium Benzoate-d5, >95% (HPLC), Benzoate-d5 (sodium), 99.50%. Offered by: GLPBio, CDN, TRC, MedChemExpress. Available pack sizes: 5mg, 1g, 100mg, 10mg, 50mg, 1mg, 50 mg, 100 mg.
Sodium 2,3,4,5,6-pentadeuteriobenzoate (CAS 62790-26-5) is a chemical compound with the molecular formula C7H5NaO2 and a molecular weight of 149.13 g/mol. IUPAC name: sodium 2,3,4,5,6-pentadeuteriobenzoate. InChIKey: WXMKPNITSTVMEF-GWVWGMRQSA-M.
| Molecular formula | C7H5NaO2 |
|---|---|
| Molecular weight | 149.13 g/mol |
| IUPAC name | sodium 2,3,4,5,6-pentadeuteriobenzoate |
| InChIKey | WXMKPNITSTVMEF-GWVWGMRQSA-M |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)[O-])[2H])[2H].[Na+] |
Computed by PubChem (NCBI)