Products 628262-26-0

CAS 628262-26-0 is the registry number for 5-Amino-4-hydroxybenzene-1,3-dicarboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-amino-4-hydroxybenzene-1,3-dicarboxylic acid;hydrochloride (CAS 628262-26-0) is a chemical compound with the molecular formula C8H8ClNO5 and a molecular weight of 233.60 g/mol. IUPAC name: 5-amino-4-hydroxybenzene-1,3-dicarboxylic acid;hydrochloride. InChIKey: CYJOAPBZDYQRLF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO5
Molecular weight233.60 g/mol
IUPAC name5-amino-4-hydroxybenzene-1,3-dicarboxylic acid;hydrochloride
InChIKeyCYJOAPBZDYQRLF-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)O)N)C(=O)O.Cl

Computed by PubChem (NCBI)