CAS 628262-26-0 is the registry number for 5-Amino-4-hydroxybenzene-1,3-dicarboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-amino-4-hydroxybenzene-1,3-dicarboxylic acid;hydrochloride (CAS 628262-26-0) is a chemical compound with the molecular formula C8H8ClNO5 and a molecular weight of 233.60 g/mol. IUPAC name: 5-amino-4-hydroxybenzene-1,3-dicarboxylic acid;hydrochloride. InChIKey: CYJOAPBZDYQRLF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO5 |
|---|---|
| Molecular weight | 233.60 g/mol |
| IUPAC name | 5-amino-4-hydroxybenzene-1,3-dicarboxylic acid;hydrochloride |
| InChIKey | CYJOAPBZDYQRLF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)N)C(=O)O.Cl |
Computed by PubChem (NCBI)