CAS 6283-24-5 appears in our catalog under these names: 4-Aminophenylmercuric Acetate (>90%), p–Aminophenylmercuric acetate, p-Aminophenylmercuric acetate, p-Aminophenylmercuric Acetat 1PC X 700MG, p-Aminophenylmercuric acetate, 99.07%. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 10mM (in 1ml dmso), 50mg, 0,25g, 0,1g, 0,5g.
Acetyloxy-(4-aminophenyl)mercury (CAS 6283-24-5) is a chemical compound with the molecular formula C8H9HgNO2 and a molecular weight of 351.75 g/mol. IUPAC name: acetyloxy-(4-aminophenyl)mercury. InChIKey: RXSUFCOOZSGWSW-UHFFFAOYSA-M.
| Molecular formula | C8H9HgNO2 |
|---|---|
| Molecular weight | 351.75 g/mol |
| IUPAC name | acetyloxy-(4-aminophenyl)mercury |
| InChIKey | RXSUFCOOZSGWSW-UHFFFAOYSA-M |
| SMILES | CC(=O)O[Hg]C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)