CAS 6283-74-5 appears in our catalog under these names: (+)-Diacetyl-l-tartaric anhydride, 97%, Di-O-acetyl-L-tartaric Anhydride, (+)-Diacetyl-L-tartaric Anhydride, >97.0%(T), (3R,4R)-2,5-Dioxotetrahydrofuran-3,4-diyl diacetate 97%, (+)-O,O'-Diacetyl-L-tartaric anhydride,. Offered by: Combi-blocks, TRC, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 1g, 5g, 2g, 500mg, 100g, 500g, 50G.
[(3R,4R)-4-acetyloxy-2,5-dioxooxolan-3-yl] acetate (CAS 6283-74-5) is a chemical compound with the molecular formula C8H8O7 and a molecular weight of 216.14 g/mol. IUPAC name: [(3R,4R)-4-acetyloxy-2,5-dioxooxolan-3-yl] acetate. InChIKey: XAKITKDHDMPGPW-PHDIDXHHSA-N.
| Molecular formula | C8H8O7 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | [(3R,4R)-4-acetyloxy-2,5-dioxooxolan-3-yl] acetate |
| InChIKey | XAKITKDHDMPGPW-PHDIDXHHSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](C(=O)OC1=O)OC(=O)C |
Computed by PubChem (NCBI)