Products 628300-71-0
CAS 628300-71-0 appears in our catalog under these names: MLN3126, MLN3126, 98%, 98%, MLN3126, 98.02%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1mg, 5mg, 100 mg, 5 mg, 25 mg.
N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfonamide (CAS 628300-71-0) is a chemical compound with the molecular formula C21H19ClN2O5S and a molecular weight of 446.9 g/mol. IUPAC name: N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfonamide. InChIKey: YSCNTJOPTXIIJO-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN2O5S |
|---|---|
| Molecular weight | 446.9 g/mol |
| IUPAC name | N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-4-propan-2-yloxybenzenesulfonamide |
| InChIKey | YSCNTJOPTXIIJO-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2)Cl)C(=O)C3=CC=[N+](C=C3)[O-] |
Computed by PubChem (NCBI)