CAS 628305-89-5 appears in our catalog under these names: 1-(3-((Dimethylamino)methyl)phenyl)ethanone, 97%, 1-{3-((Dimethylamino)methyl)phenyl}ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[3-[(dimethylamino)methyl]phenyl]ethanone (CAS 628305-89-5) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 1-[3-[(dimethylamino)methyl]phenyl]ethanone. InChIKey: ICRBYQVYMPFREK-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 1-[3-[(dimethylamino)methyl]phenyl]ethanone |
| InChIKey | ICRBYQVYMPFREK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC(=C1)CN(C)C |
Computed by PubChem (NCBI)