CAS 62851-43-8 is the registry number for Zidometacin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[1-(4-azidobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid (CAS 62851-43-8) is a chemical compound with the molecular formula C19H16N4O4 and a molecular weight of 364.4 g/mol. IUPAC name: 2-[1-(4-azidobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid. InChIKey: DCXHLPGLBYHNMU-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O4 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-[1-(4-azidobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid |
| InChIKey | DCXHLPGLBYHNMU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)N=[N+]=[N-])C=CC(=C2)OC)CC(=O)O |
Computed by PubChem (NCBI)