Products 62878-96-0

CAS 62878-96-0 is the registry number for 5-Bromobenzo[b]furan-2-carbonyl chloride, 95% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.

Structural formula: {0} (CAS {1})

5-bromo-1-benzofuran-2-carbonyl chloride (CAS 62878-96-0) is a chemical compound with the molecular formula C9H4BrClO2 and a molecular weight of 259.48 g/mol. IUPAC name: 5-bromo-1-benzofuran-2-carbonyl chloride. InChIKey: FGPAEHRRVKLUHA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4BrClO2
Molecular weight259.48 g/mol
IUPAC name5-bromo-1-benzofuran-2-carbonyl chloride
InChIKeyFGPAEHRRVKLUHA-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)C=C(O2)C(=O)Cl

Computed by PubChem (NCBI)