Products 62896-18-8
CAS 62896-18-8 is the registry number for Plumbemycin A. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
(E)-2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-5-phosphonopent-3-enoic acid (CAS 62896-18-8) is a chemical compound with the molecular formula C12H20N3O9P and a molecular weight of 381.28 g/mol. IUPAC name: (E)-2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-5-phosphonopent-3-enoic acid. InChIKey: BMFVTRZNBFRUMH-NSCUHMNNSA-N.
| Molecular formula | C12H20N3O9P |
|---|---|
| Molecular weight | 381.28 g/mol |
| IUPAC name | (E)-2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-5-phosphonopent-3-enoic acid |
| InChIKey | BMFVTRZNBFRUMH-NSCUHMNNSA-N |
| SMILES | CC(C(=O)NC(CC(=O)O)C(=O)NC(/C=C/CP(=O)(O)O)C(=O)O)N |
Computed by PubChem (NCBI)