CAS 6291-65-2 appears in our catalog under these names: Dipotassium methanedisulfonate, 95%, Potassium methanedisulfonate, 97%, Methanedisulfonic acid dipotassium salt, Methanedisulfonic acid dipotassium salt, Dipotassium methanedisulfonate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 100g, 2,5g, 250mg, 500mg.
Dipotassium;methanedisulfonate (CAS 6291-65-2) is a chemical compound with the molecular formula CH2K2O6S2 and a molecular weight of 252.35 g/mol. IUPAC name: dipotassium;methanedisulfonate. InChIKey: JSXPCVUETJIQHE-UHFFFAOYSA-L.
| Molecular formula | CH2K2O6S2 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | dipotassium;methanedisulfonate |
| InChIKey | JSXPCVUETJIQHE-UHFFFAOYSA-L |
| SMILES | C(S(=O)(=O)[O-])S(=O)(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)