Products 62929-91-3
CAS 62929-91-3 appears in our catalog under these names: Procaterol HCl, Procaterol hydrochloride, 8-Hydroxy-5-((1S,2R)-1-hydroxy-2-(isopropylamino)butyl)quinolin-2(1H)-one hydrochloride, ≥98%, ≥98%, Procaterol (hydrochloride), 99.99%, Procaterol hydrochloride, Concentration: 100 µg/ml Solvent: Methanol. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress, HPC Standards. Available pack sizes: on request, 10mg, 50mg, 5mg, 25mg, 100mg, 5 mg, 1x1ml.
8-hydroxy-5-[(1S,2R)-1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;hydrochloride (CAS 62929-91-3) is a chemical compound with the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. IUPAC name: 8-hydroxy-5-[(1S,2R)-1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;hydrochloride. InChIKey: AEQDBKHAAWUCMT-KKJWGQAZSA-N.
| Molecular formula | C16H23ClN2O3 |
|---|---|
| Molecular weight | 326.82 g/mol |
| IUPAC name | 8-hydroxy-5-[(1S,2R)-1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;hydrochloride |
| InChIKey | AEQDBKHAAWUCMT-KKJWGQAZSA-N |
| SMILES | CC[C@H]([C@H](C1=C2C=CC(=O)NC2=C(C=C1)O)O)NC(C)C.Cl |
Computed by PubChem (NCBI)