CAS 6293-66-9 appears in our catalog under these names: Diphenyliodoniump–toluenesulfonate, Diphenyliodonium 4-methylbenzenesulfonate, 95%, 95%, Diphenyliodonium 4-methylbenzenesulfonate, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 100mg, 1g, 5g.
Diphenyliodanium;4-methylbenzenesulfonate (CAS 6293-66-9) is a chemical compound with the molecular formula C19H17IO3S and a molecular weight of 452.3 g/mol. IUPAC name: diphenyliodanium;4-methylbenzenesulfonate. InChIKey: UMIKAXKFQJWKCV-UHFFFAOYSA-M.
| Molecular formula | C19H17IO3S |
|---|---|
| Molecular weight | 452.3 g/mol |
| IUPAC name | diphenyliodanium;4-methylbenzenesulfonate |
| InChIKey | UMIKAXKFQJWKCV-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C1=CC=C(C=C1)[I+]C2=CC=CC=C2 |
Computed by PubChem (NCBI)