Products 62933-57-7
CAS 62933-57-7 appears in our catalog under these names: Sapropterin Impurity 2, Di-O-Acetylbiopterin, Diacetylbiopterin. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 10mg, 5mg, 25mg, 100mg, 50mg.
[(1R,2S)-1-acetyloxy-1-(2-amino-4-oxo-3H-pteridin-6-yl)propan-2-yl] acetate (CAS 62933-57-7) is a chemical compound with the molecular formula C13H15N5O5 and a molecular weight of 321.29 g/mol. IUPAC name: [(1R,2S)-1-acetyloxy-1-(2-amino-4-oxo-3H-pteridin-6-yl)propan-2-yl] acetate. InChIKey: ZBYBSVILJUOUFR-RRAGMBSWSA-N.
| Molecular formula | C13H15N5O5 |
|---|---|
| Molecular weight | 321.29 g/mol |
| IUPAC name | [(1R,2S)-1-acetyloxy-1-(2-amino-4-oxo-3H-pteridin-6-yl)propan-2-yl] acetate |
| InChIKey | ZBYBSVILJUOUFR-RRAGMBSWSA-N |
| SMILES | C[C@@H]([C@@H](C1=CN=C2C(=N1)C(=O)NC(=N2)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)