CAS 62942-43-2 appears in our catalog under these names: (2-Oxoethyl)triphenylphosphonium chloride 98%, (Formylmethyl)triphenylphosphonium chloride, Formylmethyltriphenylphosphonium chloride/ 98%, (Formylmethyl)triphenylphosphonium Chloride, >98.0%(T), (FORMYLMETHYL)TRIPHENYLPHOSPHONIUM CHLO&. Offered by: Ambeed, GLPBio, Chemat, TCI, Sigma-Aldrich. Available pack sizes: 5g, 25g, 100g, 500g, 250g, 50g, 10G.
2-oxoethyl(triphenyl)phosphanium chloride (CAS 62942-43-2) is a chemical compound with the molecular formula C20H18ClOP and a molecular weight of 340.8 g/mol. IUPAC name: 2-oxoethyl(triphenyl)phosphanium chloride. InChIKey: RVEJRPJGKXTQIF-UHFFFAOYSA-M.
| Molecular formula | C20H18ClOP |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 2-oxoethyl(triphenyl)phosphanium chloride |
| InChIKey | RVEJRPJGKXTQIF-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC=O)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)