CAS 6295-74-5 appears in our catalog under these names: Alpha-Naphthyl Sulfate Potassium Salt, >95% (HPLC), 1-Naphthol-O-sulfate potassium. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 250mg, 500mg, 50mg, 10mg, 100mg.
Potassium naphthalen-1-yl sulfate (CAS 6295-74-5) is a chemical compound with the molecular formula C10H7KO4S and a molecular weight of 262.33 g/mol. IUPAC name: potassium naphthalen-1-yl sulfate. InChIKey: UUFYFJKBDIRBJH-UHFFFAOYSA-M.
| Molecular formula | C10H7KO4S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | potassium naphthalen-1-yl sulfate |
| InChIKey | UUFYFJKBDIRBJH-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)