CAS 62973-69-7 appears in our catalog under these names: Sodium 2-iodobenzenesulfonate, 97%, Sodium 2-Iodobenzenesulfonate, Sodium 2–Iodobenzenesulfonate, Sodium 2-Iodobenzenesulfonate, >97.0%(HPLC), 2-Iodobenzenesulfonic acid sodium salt, 95.00%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 100mg, 250mg.
Sodium 2-iodobenzenesulfonate (CAS 62973-69-7) is a chemical compound with the molecular formula C6H4INaO3S and a molecular weight of 306.06 g/mol. IUPAC name: sodium 2-iodobenzenesulfonate. InChIKey: KIPWXZMYZCPXGE-UHFFFAOYSA-M.
| Molecular formula | C6H4INaO3S |
|---|---|
| Molecular weight | 306.06 g/mol |
| IUPAC name | sodium 2-iodobenzenesulfonate |
| InChIKey | KIPWXZMYZCPXGE-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)[O-])I.[Na+] |
Computed by PubChem (NCBI)