CAS 62978-52-3 appears in our catalog under these names: Methyl (S)-2-amino-3-(4-(bis(2-chloroethyl)amino)phenyl)propanoate hydrochloride, 98%, Melphalan EP Impurity H HCl, Melphalan EP Impurity H HCl (Melphalan Methyl Ester HCl), Melphalan Impurity 8(Melphalan EP Impurity H), Melphalan Methyl Ester Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride (CAS 62978-52-3) is a chemical compound with the molecular formula C14H21Cl3N2O2 and a molecular weight of 355.7 g/mol. IUPAC name: methyl (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride. InChIKey: FHKHNGPONDWSEP-ZOWNYOTGSA-N.
| Molecular formula | C14H21Cl3N2O2 |
|---|---|
| Molecular weight | 355.7 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride |
| InChIKey | FHKHNGPONDWSEP-ZOWNYOTGSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)N(CCCl)CCCl)N.Cl |
Computed by PubChem (NCBI)