CAS 630-76-2 appears in our catalog under these names: Tetraphenylmethane, Tetraphenylmethane, 96% , Tetraphenylmethane, >96.0%(GC), Tetraphenylmethane 97%, Tetraphenylmethane, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g, 100mg.
Tritylbenzene (CAS 630-76-2) is a chemical compound with the molecular formula C25H20 and a molecular weight of 320.4 g/mol. IUPAC name: tritylbenzene. InChIKey: PEQHIRFAKIASBK-UHFFFAOYSA-N.
| Molecular formula | C25H20 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | tritylbenzene |
| InChIKey | PEQHIRFAKIASBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)