Products 630058-59-2
CAS 630058-59-2 is the registry number for Tubulin polymerization-IN-29. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-3,4,5-trimethoxybenzamide (CAS 630058-59-2) is a chemical compound with the molecular formula C25H20FNO6 and a molecular weight of 449.4 g/mol. IUPAC name: N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-3,4,5-trimethoxybenzamide. InChIKey: KHNYRHSDCRHAOK-UHFFFAOYSA-N.
| Molecular formula | C25H20FNO6 |
|---|---|
| Molecular weight | 449.4 g/mol |
| IUPAC name | N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-3,4,5-trimethoxybenzamide |
| InChIKey | KHNYRHSDCRHAOK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)NC2=C(OC3=CC=CC=C32)C(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)