CAS 6301-83-3 is the registry number for 7-(BENZYLOXY)-2H-[1,2,3]TRIAZOLO[4,5-D]PYRIMIDIN-5-AMINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg.
7-phenylmethoxy-2H-triazolo[4,5-d]pyrimidin-5-amine (CAS 6301-83-3) is a chemical compound with the molecular formula C11H10N6O and a molecular weight of 242.24 g/mol. IUPAC name: 7-phenylmethoxy-2H-triazolo[4,5-d]pyrimidin-5-amine. InChIKey: ZHTBAYPUCDCQPX-UHFFFAOYSA-N.
| Molecular formula | C11H10N6O |
|---|---|
| Molecular weight | 242.24 g/mol |
| IUPAC name | 7-phenylmethoxy-2H-triazolo[4,5-d]pyrimidin-5-amine |
| InChIKey | ZHTBAYPUCDCQPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=NC3=NNN=C32)N |
Computed by PubChem (NCBI)