CAS 630127-51-4 appears in our catalog under these names: (4-((Trimethylsilyl)ethynyl)phenyl)boronic Acid, (4–((Trimethylsilyl)ethynyl)phenyl)boronic acid, (4-[(Trimethylsilyl)ethynyl]phenyl)boronic acid, 98%, (4-((Trimethylsilyl)ethynyl)phenyl)boronic acid 98%, (4-((Trimethylsilyl)ethynyl)phenyl)boronic acid, 98%. Offered by: TRC, GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
[4-(2-trimethylsilylethynyl)phenyl]boronic acid (CAS 630127-51-4) is a chemical compound with the molecular formula C11H15BO2Si and a molecular weight of 218.13 g/mol. IUPAC name: [4-(2-trimethylsilylethynyl)phenyl]boronic acid. InChIKey: MZUXXSJYZORMJL-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2Si |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | [4-(2-trimethylsilylethynyl)phenyl]boronic acid |
| InChIKey | MZUXXSJYZORMJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C#C[Si](C)(C)C)(O)O |
Computed by PubChem (NCBI)