CAS 6303-46-4 appears in our catalog under these names: 6–Chloro–N–(3,4–dichlorophenyl)pyrimidin–4–amine, 6-Chloro-N-(3,4-dichlorophenyl)pyrimidin-4-amine, 97%. Offered by: GLPBio, AmBeed. Available pack sizes: 1g, 250mg.
6-chloro-N-(3,4-dichlorophenyl)pyrimidin-4-amine (CAS 6303-46-4) is a chemical compound with the molecular formula C10H6Cl3N3 and a molecular weight of 274.5 g/mol. IUPAC name: 6-chloro-N-(3,4-dichlorophenyl)pyrimidin-4-amine. InChIKey: DKFCSVINRQJSNI-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N3 |
|---|---|
| Molecular weight | 274.5 g/mol |
| IUPAC name | 6-chloro-N-(3,4-dichlorophenyl)pyrimidin-4-amine |
| InChIKey | DKFCSVINRQJSNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=CC(=NC=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)